C16H23BrN2O — CID 43520432
N-(6-bromo-2-pyridinyl)-4-butylcyclohexane-1-carboxamide (PubChem CID 43520432) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-4-butylcyclohexane-1-carboxamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-4-butylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 43520432 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-4-butylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2cccc(Br)n2)CC1 |
| InChI | InChI=1S/C16H23BrN2O/c1-2-3-5-12-8-10-13(11-9-12)16(20)19-15-7-4-6-14(17)18-15/h4,6-7,12-13H,2-3,5,8-11H2,1H3,(H,18,19,20) |
| InChIKey | KFXLMAOOIGSFKB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|