C9H10Br2N2O — CID 134366786
4-bromo-N-(6-bromo-2-pyridinyl)butanamide (PubChem CID 134366786) has the molecular formula C9H10Br2N2O and a molecular weight of 322.00 g/mol. Its IUPAC name is 4-bromo-N-(6-bromo-2-pyridinyl)butanamide.
| Compound Name | 4-bromo-N-(6-bromo-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 134366786 |
| Molecular Formula | C9H10Br2N2O |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 4-bromo-N-(6-bromo-2-pyridinyl)butanamide |
| SMILES | O=C(CCCBr)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C9H10Br2N2O/c10-6-2-5-9(14)13-8-4-1-3-7(11)12-8/h1,3-4H,2,5-6H2,(H,12,13,14) |
| InChIKey | JYRNKSDKGDVYCI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|