C25H21N7O2 — CID 24598227
N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide (PubChem CID 24598227) has the molecular formula C25H21N7O2 and a molecular weight of 451.49 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24598227 |
| Molecular Formula | C25H21N7O2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-pyridin-3-ylpyrazole-4-carbohydrazide |
| SMILES | CCn1c(NNC(=O)c2cn(-c3ccccc3)nc2-c2cccnc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H21N7O2/c1-2-31-24(34)19-12-6-7-13-21(19)27-25(31)29-28-23(33)20-16-32(18-10-4-3-5-11-18)30-22(20)17-9-8-14-26-15-17/h3-16H,2H2,1H3,(H,27,29)(H,28,33) |
| InChIKey | HPNUBVSXHASZPV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|