C24H20N6O2S — CID 24598222
N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carbohydrazide (PubChem CID 24598222) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24598222 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carbohydrazide |
| SMILES | CCn1c(NNC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H20N6O2S/c1-2-29-23(32)17-11-6-7-12-19(17)25-24(29)27-26-22(31)18-15-30(16-9-4-3-5-10-16)28-21(18)20-13-8-14-33-20/h3-15H,2H2,1H3,(H,25,27)(H,26,31) |
| InChIKey | UJERUEYEAIACCT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|