C23H17N5O2S — CID 27692078
N'-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1H-indole-3-carbohydrazide (PubChem CID 27692078) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N'-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1H-indole-3-carbohydrazide.
| Compound Name | N'-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 27692078 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N'-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)-1H-indole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1c[nH]c2ccccc12)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C23H17N5O2S/c29-22(17-13-24-19-10-5-4-9-16(17)19)25-26-23(30)18-14-28(15-7-2-1-3-8-15)27-21(18)20-11-6-12-31-20/h1-14,24H,(H,25,29)(H,26,30) |
| InChIKey | ZEZZJZDVCZCHAP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|