C19H15N5O2S — CID 78813902
1-phenyl-N'-(1H-pyrrole-2-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide (PubChem CID 78813902) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-phenyl-N'-(1H-pyrrole-2-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide.
| Compound Name | 1-phenyl-N'-(1H-pyrrole-2-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78813902 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-phenyl-N'-(1H-pyrrole-2-carbonyl)-3-thiophen-2-ylpyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cn(-c2ccccc2)nc1-c1cccs1)c1ccc[nH]1 |
| InChI | InChI=1S/C19H15N5O2S/c25-18(21-22-19(26)15-8-4-10-20-15)14-12-24(13-6-2-1-3-7-13)23-17(14)16-9-5-11-27-16/h1-12,20H,(H,21,25)(H,22,26) |
| InChIKey | PQNWAZDQRUOPJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|