C20H14FN3OS — CID 8745127
N-(4-fluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 8745127) has the molecular formula C20H14FN3OS and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 8745127 |
| Molecular Formula | C20H14FN3OS |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-(4-fluorophenyl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C20H14FN3OS/c21-14-8-10-15(11-9-14)22-20(25)17-13-24(16-5-2-1-3-6-16)23-19(17)18-7-4-12-26-18/h1-13H,(H,22,25) |
| InChIKey | JVWNLVDFZXLLBM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |