C32H28N6O2S2 — CID 4048100
1-phenyl-N-[4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]butyl]-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 4048100) has the molecular formula C32H28N6O2S2 and a molecular weight of 592.75 g/mol. Its IUPAC name is 1-phenyl-N-[4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]butyl]-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-phenyl-N-[4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]butyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 4048100 |
| Molecular Formula | C32H28N6O2S2 |
| Molecular Weight | 592.75 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | 1-phenyl-N-[4-[(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)amino]butyl]-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCCCNC(=O)c1cn(-c2ccccc2)nc1-c1cccs1)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C32H28N6O2S2/c39-31(25-21-37(23-11-3-1-4-12-23)35-29(25)27-15-9-19-41-27)33-17-7-8-18-34-32(40)26-22-38(24-13-5-2-6-14-24)36-30(26)28-16-10-20-42-28/h1-6,9-16,19-22H,7-8,17-18H2,(H,33,39)(H,34,40) |
| InChIKey | UIXFOAINRUFSFC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|