C22H18FN3O2S — CID 18228769
N-[2-(2-fluorophenoxy)ethyl]-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 18228769) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18228769 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccccc1F)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C22H18FN3O2S/c23-18-9-4-5-10-19(18)28-13-12-24-22(27)17-15-26(16-7-2-1-3-8-16)25-21(17)20-11-6-14-29-20/h1-11,14-15H,12-13H2,(H,24,27) |
| InChIKey | WDLCHTFRCMSRRF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|