C17H13N5O3S — CID 78809218
N-(2,4-dioxoimidazolidin-1-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 78809218) has the molecular formula C17H13N5O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is N-(2,4-dioxoimidazolidin-1-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(2,4-dioxoimidazolidin-1-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78809218 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(2,4-dioxoimidazolidin-1-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | O=C1CN(NC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)C(=O)N1 |
| InChI | InChI=1S/C17H13N5O3S/c23-14-10-22(17(25)18-14)20-16(24)12-9-21(11-5-2-1-3-6-11)19-15(12)13-7-4-8-26-13/h1-9H,10H2,(H,20,24)(H,18,23,25) |
| InChIKey | OZKNFGUFADFYKS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|