C20H22N4OS — CID 120600789
N-(2-methylpiperidin-4-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide (PubChem CID 120600789) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(2-methylpiperidin-4-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 120600789 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-1-phenyl-3-thiophen-2-ylpyrazole-4-carboxamide |
| SMILES | CC1CC(NC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)CCN1 |
| InChI | InChI=1S/C20H22N4OS/c1-14-12-15(9-10-21-14)22-20(25)17-13-24(16-6-3-2-4-7-16)23-19(17)18-8-5-11-26-18/h2-8,11,13-15,21H,9-10,12H2,1H3,(H,22,25) |
| InChIKey | DPKKZKHELWQAPO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |