C18H25N5O4 — CID 55561640
tert-butyl N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 55561640) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 55561640 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CCn1c(NNC(=O)C(C)NC(=O)OC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H25N5O4/c1-6-23-15(25)12-9-7-8-10-13(12)20-16(23)22-21-14(24)11(2)19-17(26)27-18(3,4)5/h7-11H,6H2,1-5H3,(H,19,26)(H,20,22)(H,21,24) |
| InChIKey | KUJYPESHXZWLGN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|