C18H27ClN4O3S — CID 137140916
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-3-ylhexanamide;hydrochloride (PubChem CID 137140916) has the molecular formula C18H27ClN4O3S and a molecular weight of 414.96 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-3-ylhexanamide;hydrochloride.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-3-ylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 137140916 |
| Molecular Formula | C18H27ClN4O3S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-3-ylhexanamide;hydrochloride |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CCCNC1.Cl |
| InChI | InChI=1S/C18H26N4O3S.ClH/c1-2-3-9-15(18(23)20-13-7-6-11-19-12-13)21-17-14-8-4-5-10-16(14)26(24,25)22-17;/h4-5,8,10,13,15,19H,2-3,6-7,9,11-12H2,1H3,(H,20,23)(H,21,22);1H |
| InChIKey | BDDNACMXOQDLQD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|