C18H25N3O3S — CID 135749969
(2S,3S)-N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide (PubChem CID 135749969) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is (2S,3S)-N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide.
| Compound Name | (2S,3S)-N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide |
|---|---|
| PubChem CID | 135749969 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (2S,3S)-N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H25N3O3S/c1-3-12(2)16(18(22)19-13-8-4-5-9-13)20-17-14-10-6-7-11-15(14)25(23,24)21-17/h6-7,10-13,16H,3-5,8-9H2,1-2H3,(H,19,22)(H,20,21)/t12-,16-/m0/s1 |
| InChIKey | YPRFEIDTRKHKBV-LRDDRELGSA-N |
| XLogP | 2.20 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|