C17H23N3O5S — CID 135757071
[2-(dimethylamino)-2-oxoethyl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate (PubChem CID 135757071) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 135757071 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] (2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(=O)N(C)C |
| InChI | InChI=1S/C17H23N3O5S/c1-5-11(2)15(17(22)25-10-14(21)20(3)4)18-16-12-8-6-7-9-13(12)26(23,24)19-16/h6-9,11,15H,5,10H2,1-4H3,(H,18,19)/t11-,15-/m0/s1 |
| InChIKey | LVCBEEGFIHAJGY-NHYWBVRUSA-N |
| XLogP | 0.77 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|