C20H28N4O4S — CID 135795961
N'-[(2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoyl]cyclohexanecarbohydrazide (PubChem CID 135795961) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is N'-[(2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[(2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 135795961 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N'-[(2S,3S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylpentanoyl]cyclohexanecarbohydrazide |
| SMILES | CC[C@H](C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H28N4O4S/c1-3-13(2)17(20(26)23-22-19(25)14-9-5-4-6-10-14)21-18-15-11-7-8-12-16(15)29(27,28)24-18/h7-8,11-14,17H,3-6,9-10H2,1-2H3,(H,21,24)(H,22,25)(H,23,26)/t13-,17-/m0/s1 |
| InChIKey | VMULBRBGQIIHIY-GUYCJALGSA-N |
| XLogP | 1.87 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|