C17H23N3O3S — CID 135883976
N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanamide (PubChem CID 135883976) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanamide.
| Compound Name | N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 135883976 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-cyclopentyl-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanamide |
| SMILES | CC(C)C(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-11(2)15(17(21)18-12-7-3-4-8-12)19-16-13-9-5-6-10-14(13)24(22,23)20-16/h5-6,9-12,15H,3-4,7-8H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | BUSHDMGUCHEQSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|