C17H19N3O4S — CID 135925781
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(furan-2-ylmethyl)-3-methylbutanamide (PubChem CID 135925781) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(furan-2-ylmethyl)-3-methylbutanamide.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(furan-2-ylmethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 135925781 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(furan-2-ylmethyl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H19N3O4S/c1-11(2)15(17(21)18-10-12-6-5-9-24-12)19-16-13-7-3-4-8-14(13)25(22,23)20-16/h3-9,11,15H,10H2,1-2H3,(H,18,21)(H,19,20)/t15-/m0/s1 |
| InChIKey | CNANQSWWEOKFOX-HNNXBMFYSA-N |
| XLogP | 1.66 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|