C21H20N4O6S2 — CID 135687356
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide (PubChem CID 135687356) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 135687356 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-(furan-2-ylmethylsulfamoyl)phenyl]propanamide |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H20N4O6S2/c1-14(23-20-18-9-2-3-10-19(18)33(29,30)25-20)21(26)24-15-6-4-8-17(12-15)32(27,28)22-13-16-7-5-11-31-16/h2-12,14,22H,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | ZSOZZRZYERTALK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|