C19H18F3N3O4S — CID 135931955
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-N-[4-(trifluoromethoxy)phenyl]butanamide (PubChem CID 135931955) has the molecular formula C19H18F3N3O4S and a molecular weight of 441.43 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-N-[4-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-N-[4-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 135931955 |
| Molecular Formula | C19H18F3N3O4S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methyl-N-[4-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CC(C)C(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O4S/c1-11(2)16(24-17-14-5-3-4-6-15(14)30(27,28)25-17)18(26)23-12-7-9-13(10-8-12)29-19(20,21)22/h3-11,16H,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | WMOYAWJSYIRNFU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|