C22H25N3O6S — CID 135570408
[1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate (PubChem CID 135570408) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is [1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate.
| Compound Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 135570408 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-methylbutanoate |
| SMILES | COc1ccccc1NC(=O)C(C)OC(=O)C(/N=C1\NS(=O)(=O)c2ccccc21)C(C)C |
| InChI | InChI=1S/C22H25N3O6S/c1-13(2)19(24-20-15-9-5-8-12-18(15)32(28,29)25-20)22(27)31-14(3)21(26)23-16-10-6-7-11-17(16)30-4/h5-14,19H,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | BRYGNDBTCBYXFN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|