C18H19N3O4S — CID 135625180
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methoxyphenyl)methyl]propanamide (PubChem CID 135625180) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methoxyphenyl)methyl]propanamide.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 135625180 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2-methoxyphenyl)methyl]propanamide |
| SMILES | COc1ccccc1CNC(=O)[C@H](C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H19N3O4S/c1-12(18(22)19-11-13-7-3-5-9-15(13)25-2)20-17-14-8-4-6-10-16(14)26(23,24)21-17/h3-10,12H,11H2,1-2H3,(H,19,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | ZPBYWOBUZCGPKT-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|