C18H15N3O4S — CID 135597921
(2-cyanophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135597921) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (2-cyanophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135597921 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (2-cyanophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1ccccc1C#N |
| InChI | InChI=1S/C18H15N3O4S/c1-12(18(22)25-11-14-7-3-2-6-13(14)10-19)20-17-15-8-4-5-9-16(15)26(23,24)21-17/h2-9,12H,11H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | BCSYRHJYVYEAKO-LBPRGKRZSA-N |
| XLogP | 1.73 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|