C17H14Cl2N2O4S — CID 135582697
(3,4-dichlorophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135582697) has the molecular formula C17H14Cl2N2O4S and a molecular weight of 413.28 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (3,4-dichlorophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135582697 |
| Molecular Formula | C17H14Cl2N2O4S |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | (3,4-dichlorophenyl)methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N2O4S/c1-10(17(22)25-9-11-6-7-13(18)14(19)8-11)20-16-12-4-2-3-5-15(12)26(23,24)21-16/h2-8,10H,9H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | WDVQZBAHSWOEOF-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|