C16H13ClN2O5S2 — CID 135528012
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135528012) has the molecular formula C16H13ClN2O5S2 and a molecular weight of 412.88 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135528012 |
| Molecular Formula | C16H13ClN2O5S2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H13ClN2O5S2/c1-9(16(21)24-8-11(20)12-6-7-14(17)25-12)18-15-10-4-2-3-5-13(10)26(22,23)19-15/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | LSQFMTWLMRXIRO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|