C22H24N2O5S — CID 135828264
[2-(4-butylphenyl)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135828264) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is [2-(4-butylphenyl)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(4-butylphenyl)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135828264 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [2-(4-butylphenyl)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CCCCc1ccc(C(=O)COC(=O)[C@H](C)/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-4-7-16-10-12-17(13-11-16)19(25)14-29-22(26)15(2)23-21-18-8-5-6-9-20(18)30(27,28)24-21/h5-6,8-13,15H,3-4,7,14H2,1-2H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | QEYOPDNCXNYXEJ-HNNXBMFYSA-N |
| XLogP | 2.88 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|