C24H21N3O5S — CID 135894794
[4-(phenylcarbamoyl)phenyl]methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135894794) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl]methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [4-(phenylcarbamoyl)phenyl]methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135894794 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl]methyl (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-16(25-22-20-9-5-6-10-21(20)33(30,31)27-22)24(29)32-15-17-11-13-18(14-12-17)23(28)26-19-7-3-2-4-8-19/h2-14,16H,15H2,1H3,(H,25,27)(H,26,28)/t16-/m0/s1 |
| InChIKey | QFFDWWMRFILBAX-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|