C19H16F3N3O6S — CID 135756843
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135756843) has the molecular formula C19H16F3N3O6S and a molecular weight of 471.41 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135756843 |
| Molecular Formula | C19H16F3N3O6S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O6S/c1-11(23-17-14-4-2-3-5-15(14)32(28,29)25-17)18(27)30-10-16(26)24-12-6-8-13(9-7-12)31-19(20,21)22/h2-9,11H,10H2,1H3,(H,23,25)(H,24,26)/t11-/m1/s1 |
| InChIKey | NNEMWPLSAUQMSP-LLVKDONJSA-N |
| XLogP | 2.19 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|