C21H21N3O7S — CID 136755002
ethyl 2-[[2-[(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]oxyacetyl]amino]benzoate (PubChem CID 136755002) has the molecular formula C21H21N3O7S and a molecular weight of 459.48 g/mol. Its IUPAC name is ethyl 2-[[2-[(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 136755002 |
| Molecular Formula | C21H21N3O7S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | ethyl 2-[[2-[(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)[C@H](C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O7S/c1-3-30-21(27)14-8-4-6-10-16(14)23-18(25)12-31-20(26)13(2)22-19-15-9-5-7-11-17(15)32(28,29)24-19/h4-11,13H,3,12H2,1-2H3,(H,22,24)(H,23,25)/t13-/m0/s1 |
| InChIKey | GXYUYIRQDFRJCE-ZDUSSCGKSA-N |
| XLogP | 1.47 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|