C19H19N3O5S — CID 135756856
[2-(3-methylanilino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135756856) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135756856 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)[C@@H](C)/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-12-6-5-7-14(10-12)21-17(23)11-27-19(24)13(2)20-18-15-8-3-4-9-16(15)28(25,26)22-18/h3-10,13H,11H2,1-2H3,(H,20,22)(H,21,23)/t13-/m1/s1 |
| InChIKey | SRPUWCRBQPVRLN-CYBMUJFWSA-N |
| XLogP | 1.60 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|