C18H15ClFN3O5S — CID 135756840
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135756840) has the molecular formula C18H15ClFN3O5S and a molecular weight of 439.85 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135756840 |
| Molecular Formula | C18H15ClFN3O5S |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3O5S/c1-10(21-17-12-4-2-3-5-15(12)29(26,27)23-17)18(25)28-9-16(24)22-11-6-7-14(20)13(19)8-11/h2-8,10H,9H2,1H3,(H,21,23)(H,22,24)/t10-/m0/s1 |
| InChIKey | WNRNGZBUTNRGLE-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|