C17H22N4O6S — CID 135756826
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135756826) has the molecular formula C17H22N4O6S and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135756826 |
| Molecular Formula | C17H22N4O6S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)[C@@H](C)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H22N4O6S/c1-10(2)8-18-17(24)20-14(22)9-27-16(23)11(3)19-15-12-6-4-5-7-13(12)28(25,26)21-15/h4-7,10-11H,8-9H2,1-3H3,(H,19,21)(H2,18,20,22,24)/t11-/m1/s1 |
| InChIKey | OYJVMMKGNKCMEA-LLVKDONJSA-N |
| XLogP | 0.14 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|