C17H15F2N3O4S — CID 135625193
(2S)-N-[4-(difluoromethoxy)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 135625193) has the molecular formula C17H15F2N3O4S and a molecular weight of 395.39 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethoxy)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | (2S)-N-[4-(difluoromethoxy)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135625193 |
| Molecular Formula | C17H15F2N3O4S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (2S)-N-[4-(difluoromethoxy)phenyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | C[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H15F2N3O4S/c1-10(16(23)21-11-6-8-12(9-7-11)26-17(18)19)20-15-13-4-2-3-5-14(13)27(24,25)22-15/h2-10,17H,1H3,(H,20,22)(H,21,23)/t10-/m0/s1 |
| InChIKey | QBBDJHNEZKJJIP-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|