C19H20BrN3O3S — CID 136933026
N-(4-bromophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanamide (PubChem CID 136933026) has the molecular formula C19H20BrN3O3S and a molecular weight of 450.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanamide.
| Compound Name | N-(4-bromophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 136933026 |
| Molecular Formula | C19H20BrN3O3S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylpentanamide |
| SMILES | CC(C)CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H20BrN3O3S/c1-12(2)11-16(19(24)21-14-9-7-13(20)8-10-14)22-18-15-5-3-4-6-17(15)27(25,26)23-18/h3-10,12,16H,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | OTBBRVFLBODVJA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|