C20H22FN3O3S — CID 136934785
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide (PubChem CID 136934785) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 136934785 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluoro-4-methylphenyl)-4-methylpentanamide |
| SMILES | Cc1ccc(NC(=O)C(CC(C)C)/N=C2\NS(=O)(=O)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-12(2)10-17(20(25)23-16-9-8-13(3)11-15(16)21)22-19-14-6-4-5-7-18(14)28(26,27)24-19/h4-9,11-12,17H,10H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | YCBIGBLKJSOLCL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|