C15H19N3O5S — CID 136949455
2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]-4-methylpentanoic acid (PubChem CID 136949455) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 136949455 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C/N=C1\NS(=O)(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H19N3O5S/c1-9(2)7-11(15(20)21)17-13(19)8-16-14-10-5-3-4-6-12(10)24(22,23)18-14/h3-6,9,11H,7-8H2,1-2H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | GYTKVNNPEUXAKE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|