C21H25N3O3S — CID 135905206
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-3-methyl-1-phenylbutyl]propanamide (PubChem CID 135905206) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-3-methyl-1-phenylbutyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-3-methyl-1-phenylbutyl]propanamide |
|---|---|
| PubChem CID | 135905206 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(1S)-3-methyl-1-phenylbutyl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-15(2)14-18(16-8-4-3-5-9-16)23-20(25)12-13-22-21-17-10-6-7-11-19(17)28(26,27)24-21/h3-11,15,18H,12-14H2,1-2H3,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | ABACTCLYILYENO-SFHVURJKSA-N |
| XLogP | 3.02 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|