C14H18N4O4S — CID 135926631
N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-2-methylpropanehydrazide (PubChem CID 135926631) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-2-methylpropanehydrazide.
| Compound Name | N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 135926631 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N'-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyl]-2-methylpropanehydrazide |
| SMILES | CC(C)C(=O)NNC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H18N4O4S/c1-9(2)14(20)17-16-12(19)7-8-15-13-10-5-3-4-6-11(10)23(21,22)18-13/h3-6,9H,7-8H2,1-2H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | VACKHMIQXZJSHR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|