C19H21N3O4S — CID 135995514
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 135995514) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 135995514 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccccc1CCNC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O4S/c1-26-16-8-4-2-6-14(16)10-12-20-18(23)11-13-21-19-15-7-3-5-9-17(15)27(24,25)22-19/h2-9H,10-13H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | UMPXDHVDOGIUGX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|