C20H23N3O3S — CID 135930572
N-(4-butan-2-ylphenyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide (PubChem CID 135930572) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide.
| Compound Name | N-(4-butan-2-ylphenyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135930572 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanamide |
| SMILES | CCC(C)c1ccc(NC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-3-14(2)15-8-10-16(11-9-15)22-19(24)12-13-21-20-17-6-4-5-7-18(17)27(25,26)23-20/h4-11,14H,3,12-13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | SVHKQZOVOPKBPR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|