C14H17N3O5S — CID 136966144
2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]propanoic acid (PubChem CID 136966144) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]propanoic acid.
| Compound Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 136966144 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoylamino]propanoic acid |
| SMILES | CC(NC(=O)CCC/N=C1\NS(=O)(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C14H17N3O5S/c1-9(14(19)20)16-12(18)7-4-8-15-13-10-5-2-3-6-11(10)23(21,22)17-13/h2-3,5-6,9H,4,7-8H2,1H3,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | PCDDNKIUEMDXRI-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|