C17H27ClN4O3S — CID 137064330
N-(3-aminobutyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride (PubChem CID 137064330) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is N-(3-aminobutyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 137064330 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-(3-aminobutyl)-6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21.Cl |
| InChI | InChI=1S/C17H26N4O3S.ClH/c1-13(18)10-12-19-16(22)9-3-2-6-11-20-17-14-7-4-5-8-15(14)25(23,24)21-17;/h4-5,7-8,13H,2-3,6,9-12,18H2,1H3,(H,19,22)(H,20,21);1H |
| InChIKey | DUQFLDNHBAIXTI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|