C19H20FN3O3S — CID 137275630
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluorophenyl)hexanamide (PubChem CID 137275630) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluorophenyl)hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 137275630 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(2-fluorophenyl)hexanamide |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)Nc1ccccc1F |
| InChI | InChI=1S/C19H20FN3O3S/c20-15-9-4-5-10-16(15)22-18(24)12-2-1-7-13-21-19-14-8-3-6-11-17(14)27(25,26)23-19/h3-6,8-11H,1-2,7,12-13H2,(H,21,23)(H,22,24) |
| InChIKey | CWPVQHCATBAXIF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|