C23H24FN5O3S — CID 136967091
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]hexanamide (PubChem CID 136967091) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]hexanamide |
|---|---|
| PubChem CID | 136967091 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]hexanamide |
| SMILES | Cc1cc(NC(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C23H24FN5O3S/c1-16-15-21(29(27-16)18-12-10-17(24)11-13-18)26-22(30)9-3-2-6-14-25-23-19-7-4-5-8-20(19)33(31,32)28-23/h4-5,7-8,10-13,15H,2-3,6,9,14H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | CKFIMESXVLNYRB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|