C26H26FN3O4S — CID 135973893
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-[(3-fluorophenoxy)methyl]phenyl]hexanamide (PubChem CID 135973893) has the molecular formula C26H26FN3O4S and a molecular weight of 495.58 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-[(3-fluorophenoxy)methyl]phenyl]hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-[(3-fluorophenoxy)methyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 135973893 |
| Molecular Formula | C26H26FN3O4S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[3-[(3-fluorophenoxy)methyl]phenyl]hexanamide |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)Nc1cccc(COc2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H26FN3O4S/c27-20-9-7-11-22(17-20)34-18-19-8-6-10-21(16-19)29-25(31)14-2-1-5-15-28-26-23-12-3-4-13-24(23)35(32,33)30-26/h3-4,6-13,16-17H,1-2,5,14-15,18H2,(H,28,30)(H,29,31) |
| InChIKey | YELYJEMTOWCKHE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|