C22H24FN3O3S2 — CID 135996770
6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide (PubChem CID 135996770) has the molecular formula C22H24FN3O3S2 and a molecular weight of 461.58 g/mol. Its IUPAC name is 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide.
| Compound Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide |
|---|---|
| PubChem CID | 135996770 |
| Molecular Formula | C22H24FN3O3S2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)NC1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C22H24FN3O3S2/c23-15-9-10-19-17(14-15)18(11-13-30-19)25-21(27)8-2-1-5-12-24-22-16-6-3-4-7-20(16)31(28,29)26-22/h3-4,6-7,9-10,14,18H,1-2,5,8,11-13H2,(H,24,26)(H,25,27) |
| InChIKey | OJDGWWQOARNLOB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|