C15H20FNO2S — CID 56684412
4-ethoxy-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide (PubChem CID 56684412) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-ethoxy-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide.
| Compound Name | 4-ethoxy-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide |
|---|---|
| PubChem CID | 56684412 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-ethoxy-N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)butanamide |
| SMILES | CCOCCCC(=O)NC1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C15H20FNO2S/c1-2-19-8-3-4-15(18)17-13-7-9-20-14-6-5-11(16)10-12(13)14/h5-6,10,13H,2-4,7-9H2,1H3,(H,17,18) |
| InChIKey | RSTUJAFNGXCIHZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|