C16H22N4O3S — CID 137019861
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-4-ylbutanamide (PubChem CID 137019861) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-4-ylbutanamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 137019861 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-piperidin-4-ylbutanamide |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)NC1CCNCC1 |
| InChI | InChI=1S/C16H22N4O3S/c21-15(19-12-7-10-17-11-8-12)6-3-9-18-16-13-4-1-2-5-14(13)24(22,23)20-16/h1-2,4-5,12,17H,3,6-11H2,(H,18,20)(H,19,21) |
| InChIKey | WKOSPXBYGFQIKL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|