C17H25ClN4O3S — CID 137081443
4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)butanamide;hydrochloride (PubChem CID 137081443) has the molecular formula C17H25ClN4O3S and a molecular weight of 400.93 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)butanamide;hydrochloride.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 137081443 |
| Molecular Formula | C17H25ClN4O3S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)butanamide;hydrochloride |
| SMILES | CC1CCNCC1NC(=O)CCC/N=C1\NS(=O)(=O)c2ccccc21.Cl |
| InChI | InChI=1S/C17H24N4O3S.ClH/c1-12-8-10-18-11-14(12)20-16(22)7-4-9-19-17-13-5-2-3-6-15(13)25(23,24)21-17;/h2-3,5-6,12,14,18H,4,7-11H2,1H3,(H,19,21)(H,20,22);1H |
| InChIKey | WZTQNNJENGEOJP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|