C16H22N4O3S — CID 137168842
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)propanamide (PubChem CID 137168842) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)propanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 137168842 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-(4-methylpiperidin-3-yl)propanamide |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CNCCC1C |
| InChI | InChI=1S/C16H22N4O3S/c1-10-7-8-17-9-13(10)19-16(21)11(2)18-15-12-5-3-4-6-14(12)24(22,23)20-15/h3-6,10-11,13,17H,7-9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | JPDHUISNFJWUBS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|